![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Zomboat/ | 2025-05-05 18:23 | - | |
| Yugioh Gx/ | 2025-05-05 18:23 | - | |
| Young Rock/ | 2025-05-05 18:23 | - | |
| Yellowstone/ | 2025-05-05 18:23 | - | |
| Wrecked/ | 2025-05-05 18:23 | - | |
| Wolf Pack/ | 2025-05-05 18:23 | - | |
| Wind Breaker/ | 2025-05-05 18:23 | - | |
| Willow/ | 2025-05-05 18:23 | - | |
| Wilderness/ | 2025-05-05 18:23 | - | |
| Wilder/ | 2025-05-05 18:23 | - | |
| Why Women Kill/ | 2025-05-05 18:23 | - | |
| Why Are You Like This/ | 2025-05-05 18:23 | - | |
| Who Is Erin Carter/ | 2025-05-05 18:23 | - | |
| White Gold/ | 2025-05-05 18:23 | - | |
| Where Is Marta/ | 2025-05-05 18:23 | - | |
| Westworld/ | 2025-05-05 18:23 | - | |
| Weekend Family/ | 2025-05-05 18:23 | - | |
| Wayward Pines/ | 2025-05-05 18:23 | - | |
| Wayne/ | 2025-05-05 18:23 | - | |
| Wandavision/ | 2025-05-05 18:23 | - | |
| Wakefield/ | 2025-05-05 18:23 | - | |
| Waco The Aftermath/ | 2025-05-05 18:23 | - | |
| Vtc/ | 2025-05-05 18:23 | - | |
| Vost My Military Val..> | 2025-05-05 18:23 | - | |
| Vost Macgruber/ | 2025-05-05 18:23 | - | |
| Vost Hellsing Ultimate/ | 2025-05-05 18:23 | - | |
| Vost Descendants Of ..> | 2025-05-05 18:23 | - | |
| Vo Poker Face Vost/ | 2025-05-05 18:23 | - | |
| Vo Mrs Davis Vost/ | 2025-05-05 18:23 | - | |
| Virgin River/ | 2025-05-05 18:23 | - | |
| Vigil/ | 2025-05-05 18:23 | - | |
| Victoria/ | 2025-05-05 18:23 | - | |
| Vers Les Étoiles/ | 2025-05-05 18:23 | - | |
| Vagrant Queen/ | 2025-05-05 18:23 | - | |
| Uzakichan Wants To H..> | 2025-05-05 18:23 | - | |
| Utopia/ | 2025-05-05 18:23 | - | |
| Upload/ | 2025-05-05 18:23 | - | |
| Unorthodox/ | 2025-05-05 18:23 | - | |
| Une Si Longue Nuit/ | 2025-05-05 18:23 | - | |
| Une Lueur Despoir/ | 2025-05-05 18:23 | - | |
| Une Famille Formidable/ | 2025-05-05 18:23 | - | |
| Une Île/ | 2025-05-05 18:23 | - | |
| Une Équipe Hors Du ..> | 2025-05-05 18:23 | - | |
| Undone/ | 2025-05-05 18:23 | - | |
| Un Ami Aux Petits So..> | 2025-05-05 18:23 | - | |
| Ultraman/ | 2025-05-05 18:23 | - | |
| Ugly Betty/ | 2025-05-05 18:23 | - | |
| Trying/ | 2025-05-05 18:23 | - | |
| True Detective/ | 2025-05-05 18:23 | - | |
| Tribes Of Europa/ | 2025-05-05 18:23 | - | |
| Trauma/ | 2025-05-05 18:23 | - | |
| Transplanté/ | 2025-05-05 18:23 | - | |
| Tout Le Monde Détes..> | 2025-05-05 18:23 | - | |
| Tous Les Jours La M..> | 2025-05-05 18:23 | - | |
| Toukin Le Chienrequin/ | 2025-05-05 18:23 | - | |
| Top Boy/ | 2025-05-05 18:23 | - | |
| To The Lake/ | 2025-05-05 18:23 | - | |
| Tiny Pretty Things/ | 2025-05-05 18:23 | - | |
| Timeless/ | 2025-05-05 18:23 | - | |
| Time/ | 2025-05-05 18:23 | - | |
| Those Who Kill/ | 2025-05-05 18:23 | - | |
| This Way Up/ | 2025-05-05 18:23 | - | |
| This Is Us/ | 2025-05-05 18:23 | - | |
| Theodosia/ | 2025-05-05 18:23 | - | |
| The Witcher Lhérita..> | 2025-05-05 18:23 | - | |
| The Witcher/ | 2025-05-05 18:23 | - | |
| The White Lotus/ | 2025-05-05 18:23 | - | |
| The Walking Dead/ | 2025-05-05 18:23 | - | |
| The Village/ | 2025-05-05 18:23 | - | |
| The Victim/ | 2025-05-05 18:23 | - | |
| The Vampire Diaries/ | 2025-05-05 18:23 | - | |
| The Tower/ | 2025-05-05 18:23 | - | |
| The Titan Games/ | 2025-05-05 18:23 | - | |
| The Time Travelers W..> | 2025-05-05 18:23 | - | |
| The Thing About Pam/ | 2025-05-05 18:23 | - | |
| The Son/ | 2025-05-05 18:23 | - | |
| The Society/ | 2025-05-05 18:23 | - | |
| The Sister/ | 2025-05-05 18:23 | - | |
| The Signal/ | 2025-05-05 18:23 | - | |
| The Shield/ | 2025-05-05 18:23 | - | |
| The Royals/ | 2025-05-05 18:23 | - | |
| The Rook/ | 2025-05-05 18:23 | - | |
| The Rising Of The Sh..> | 2025-05-05 18:23 | - | |
| The Resort/ | 2025-05-05 18:23 | - | |
| The Republic Of Sarah/ | 2025-05-05 18:23 | - | |
| The Recruit/ | 2025-05-05 18:23 | - | |
| The Plot Against Ame..> | 2025-05-05 18:23 | - | |
| The Penguin/ | 2025-05-05 18:23 | - | |
| The Oval/ | 2025-05-05 18:23 | - | |
| The Outpost/ | 2025-05-05 18:23 | - | |
| The Outlaws/ | 2025-05-05 18:23 | - | |
| The Other Two/ | 2025-05-05 18:23 | - | |
| The Orville/ | 2025-05-05 18:23 | - | |
| The One/ | 2025-05-05 18:23 | - | |
| The Old Man/ | 2025-05-05 18:23 | - | |
| The Night Of/ | 2025-05-05 18:23 | - | |
| The New Pope/ | 2025-05-05 18:23 | - | |
| The Mosquito Coast/ | 2025-05-05 18:23 | - | |
| The Midnight Club/ | 2025-05-05 18:23 | - | |
| The League/ | 2025-05-05 18:23 | - | |
| The Lake/ | 2025-05-05 18:23 | - | |
| The L Word/ | 2025-05-05 18:23 | - | |
| The King/ | 2025-05-05 18:23 | - | |
| The Innocents/ | 2025-05-05 18:23 | - | |
| The Innocent/ | 2025-05-05 18:23 | - | |
| The Hunting/ | 2025-05-05 18:23 | - | |
| The Hunt For A Killer/ | 2025-05-05 18:23 | - | |
| The Horror Of Dolore..> | 2025-05-05 18:23 | - | |
| The Guardians Of Jus..> | 2025-05-05 18:23 | - | |
| The Greatest Demon L..> | 2025-05-05 18:23 | - | |
| The Great North/ | 2025-05-05 18:23 | - | |
| The Great/ | 2025-05-05 18:23 | - | |
| The Good Lord Bird/ | 2025-05-05 18:23 | - | |
| The Good Fight/ | 2025-05-05 18:23 | - | |
| The Girl In The Woods/ | 2025-05-05 18:23 | - | |
| The Gilded Age/ | 2025-05-05 18:23 | - | |
| The Get Down/ | 2025-05-05 18:23 | - | |
| The Genius Princes G..> | 2025-05-05 18:23 | - | |
| The Franchise/ | 2025-05-05 18:23 | - | |
| The Flash/ | 2025-05-05 18:23 | - | |
| The Fix/ | 2025-05-05 18:23 | - | |
| The First Lady/ | 2025-05-05 18:23 | - | |
| The End Of The Fing ..> | 2025-05-05 18:23 | - | |
| The Detour/ | 2025-05-05 18:23 | - | |
| The Dawn Of The Witch/ | 2025-05-05 18:23 | - | |
| The Curse/ | 2025-05-05 18:23 | - | |
| The Control Room/ | 2025-05-05 18:23 | - | |
| The Climb/ | 2025-05-05 18:23 | - | |
| The Cleveland Show/ | 2025-05-05 18:23 | - | |
| The Cleaning Lady/ | 2025-05-05 18:23 | - | |
| The Chi/ | 2025-05-05 18:23 | - | |
| The Brink/ | 2025-05-05 18:23 | - | |
| The Brave Ones/ | 2025-05-05 18:23 | - | |
| The Boys/ | 2025-05-05 18:23 | - | |
| The Borgias/ | 2025-05-05 18:23 | - | |
| The Billion Dollar C..> | 2025-05-05 18:23 | - | |
| The Big Bang Theory/ | 2025-05-05 18:23 | - | |
| The Bay/ | 2025-05-05 18:23 | - | |
| The Americans/ | 2025-05-05 18:23 | - | |
| The Acolyte/ | 2025-05-05 18:23 | - | |
| That 90S Show/ | 2025-05-05 18:23 | - | |
| That 70S Show/ | 2025-05-05 18:23 | - | |
| Tandem/ | 2025-05-05 18:23 | - | |
| Tête À Tête/ | 2025-05-05 18:23 | - | |
| Swordgai The Animation/ | 2025-05-05 18:23 | - | |
| Suzhal Le Vortex/ | 2025-05-05 18:23 | - | |
| Surrealestate/ | 2025-05-05 18:23 | - | |
| Sur La Trace/ | 2025-05-05 18:23 | - | |
| Superman Lois/ | 2025-05-05 18:23 | - | |
| Supergirl/ | 2025-05-05 18:23 | - | |
| Super Détectives/ | 2025-05-05 18:23 | - | |
| Sthlm Blackout/ | 2025-05-05 18:23 | - | |
| Stella Blómkvist/ | 2025-05-05 18:23 | - | |
| Stat/ | 2025-05-05 18:23 | - | |
| Stargirl/ | 2025-05-05 18:23 | - | |
| Stargate Sg1/ | 2025-05-05 18:23 | - | |
| Star Wars Tales Of T..> | 2025-05-05 18:23 | - | |
| Star Trek Lower Decks/ | 2025-05-05 18:23 | - | |
| Squid Game Le Défi/ | 2025-05-05 18:23 | - | |
| Squid Game/ | 2025-05-05 18:23 | - | |
| Spy Kids Mission Cri..> | 2025-05-05 18:23 | - | |
| Spinning Out/ | 2025-05-05 18:23 | - | |
| Spides/ | 2025-05-05 18:23 | - | |
| Spartacus/ | 2025-05-05 18:23 | - | |
| Soundtrack 1/ | 2025-05-05 18:23 | - | |
| Sophie Cross/ | 2025-05-05 18:23 | - | |
| Sons Of Anarchy/ | 2025-05-05 18:23 | - | |
| Sonic Prime/ | 2025-05-05 18:23 | - | |
| Son Royaume/ | 2025-05-05 18:23 | - | |
| Somebody/ | 2025-05-05 18:23 | - | |
| Sombre Désir Sd/ | 2025-05-05 18:23 | - | |
| Solo Leveling/ | 2025-05-05 18:23 | - | |
| Solar Opposites/ | 2025-05-05 18:23 | - | |
| Soderzhanki Russian ..> | 2025-05-05 18:23 | - | |
| So Help Me Todd/ | 2025-05-05 18:23 | - | |
| Snowpiercer/ | 2025-05-05 18:23 | - | |
| Snowfall/ | 2025-05-05 18:23 | - | |
| Smiley/ | 2025-05-05 18:23 | - | |
| Smallville/ | 2025-05-05 18:23 | - | |
| Small Axe/ | 2025-05-05 18:23 | - | |
| Sliders Les Mondes P..> | 2025-05-05 18:23 | - | |
| Sleeping Dog/ | 2025-05-05 18:23 | - | |
| Skruk/ | 2025-05-05 18:23 | - | |
| Skins/ | 2025-05-05 18:23 | - | |
| Shooter/ | 2025-05-05 18:23 | - | |
| Shogun Shōgun/ | 2025-05-05 18:23 | - | |
| Shehulk Avocate/ | 2025-05-05 18:23 | - | |
| She/ | 2025-05-05 18:23 | - | |
| Shanty Town/ | 2025-05-05 18:23 | - | |
| Shantaram/ | 2025-05-05 18:23 | - | |
| Shadow And Bone La S..> | 2025-05-05 18:23 | - | |
| Sexy Dance/ | 2025-05-05 18:23 | - | |
| Sexlife/ | 2025-05-05 18:23 | - | |
| Sex Education/ | 2025-05-05 18:23 | - | |
| Sense8/ | 2025-05-05 18:23 | - | |
| Seinfeld/ | 2025-05-05 18:23 | - | |
| See/ | 2025-05-05 18:23 | - | |
| Secret City/ | 2025-05-05 18:23 | - | |
| School Spirits/ | 2025-05-05 18:23 | - | |
| Schmigadoon/ | 2025-05-05 18:23 | - | |
| Scandal/ | 2025-05-05 18:23 | - | |
| Saving Hope Audelà ..> | 2025-05-05 18:23 | - | |
| Savage Beauty/ | 2025-05-05 18:23 | - | |
| Saturday Morning All..> | 2025-05-05 18:23 | - | |
| Santo/ | 2025-05-05 18:23 | - | |
| Sans Un Mot/ | 2025-05-05 18:23 | - | |
| Sandman/ | 2025-05-05 18:23 | - | |
| Sam/ | 2025-05-05 18:23 | - | |
| Saint X/ | 2025-05-05 18:23 | - | |
| Safe/ | 2025-05-05 18:23 | - | |
| Run The World/ | 2025-05-05 18:23 | - | |
| Run/ | 2025-05-05 18:23 | - | |
| Roswell New Mexico/ | 2025-05-05 18:23 | - | |
| Room 104/ | 2025-05-05 18:23 | - | |
| Rookie Cops/ | 2025-05-05 18:23 | - | |
| Ripley/ | 2025-05-05 18:23 | - | |
| Rictus/ | 2025-05-05 18:23 | - | |
| Rick Et Morty Lanime/ | 2025-05-05 18:23 | - | |
| Rick Et Morty/ | 2025-05-05 18:23 | - | |
| Riches/ | 2025-05-05 18:23 | - | |
| Reyka/ | 2025-05-05 18:23 | - | |
| Revenge/ | 2025-05-05 18:23 | - | |
| Retour Dun Gangster ..> | 2025-05-05 18:23 | - | |
| Respirer/ | 2025-05-05 18:23 | - | |
| Respira/ | 2025-05-05 18:23 | - | |
| Resident Evil Infini..> | 2025-05-05 18:23 | - | |
| Remember You/ | 2025-05-05 18:23 | - | |
| Remarriage Desires/ | 2025-05-05 18:23 | - | |
| Reginald The Vampire/ | 2025-05-05 18:23 | - | |
| Red Eye/ | 2025-05-05 18:23 | - | |
| Red Election/ | 2025-05-05 18:23 | - | |
| Rebelde/ | 2025-05-05 18:23 | - | |
| Real Humans/ | 2025-05-05 18:23 | - | |
| Ranelot Et Bufolet/ | 2025-05-05 18:23 | - | |
| Ramy/ | 2025-05-05 18:23 | - | |
| Ragnarök/ | 2025-05-05 18:23 | - | |
| Racines/ | 2025-05-05 18:23 | - | |
| Résurrection/ | 2025-05-05 18:23 | - | |
| Queer Force/ | 2025-05-05 18:23 | - | |
| Queer As Folk/ | 2025-05-05 18:23 | - | |
| Queens/ | 2025-05-05 18:23 | - | |
| Queen/ | 2025-05-05 18:23 | - | |
| Quand Revient Le Calme/ | 2025-05-05 18:23 | - | |
| Psychopass Hevc/ | 2025-05-05 18:23 | - | |
| Proven Innocent/ | 2025-05-05 18:23 | - | |
| Promised Land/ | 2025-05-05 18:23 | - | |
| Professionals/ | 2025-05-05 18:23 | - | |
| Profession Reporter/ | 2025-05-05 18:23 | - | |
| Prodigal Son/ | 2025-05-05 18:23 | - | |
| Pretty Little Liars ..> | 2025-05-05 18:23 | - | |
| Pretty Little Liars/ | 2025-05-05 18:23 | - | |
| Preacher/ | 2025-05-05 18:23 | - | |
| Poursuis Tes Rêves/ | 2025-05-05 18:23 | - | |
| Pour Toujours Plus U..> | 2025-05-05 18:23 | - | |
| Population 11/ | 2025-05-05 18:23 | - | |
| Poldark/ | 2025-05-05 18:23 | - | |
| Plus Belle La Vie/ | 2025-05-05 18:23 | - | |
| Plan B/ | 2025-05-05 18:23 | - | |
| Piste Noire/ | 2025-05-05 18:23 | - | |
| Phantom Pups En Chai..> | 2025-05-05 18:23 | - | |
| Peur Sur Le Lac/ | 2025-05-05 18:23 | - | |
| Perfect Life Vida Pe..> | 2025-05-05 18:23 | - | |
| Percy Jackson Et Les..> | 2025-05-05 18:23 | - | |
| Peppa Pig/ | 2025-05-05 18:23 | - | |
| Pearson/ | 2025-05-05 18:23 | - | |
| Peaky Blinders/ | 2025-05-05 18:23 | - | |
| Patria/ | 2025-05-05 18:23 | - | |
| Partisan/ | 2025-05-05 18:23 | - | |
| Parole De Cowboy/ | 2025-05-05 18:23 | - | |
| Paris Has Fallen/ | 2025-05-05 18:23 | - | |
| Parasyte/ | 2025-05-05 18:23 | - | |
| Paranormal/ | 2025-05-05 18:23 | - | |
| Par Tous Les Moyens/ | 2025-05-05 18:23 | - | |
| Périphériques Les ..> | 2025-05-05 18:23 | - | |
| Ozark/ | 2025-05-05 18:23 | - | |
| Our Boys/ | 2025-05-05 18:23 | - | |
| Osmosis/ | 2025-05-05 18:23 | - | |
| Opérations Spécial..> | 2025-05-05 18:23 | - | |
| Opération Banco Cen..> | 2025-05-05 18:23 | - | |
| Oni Légendes Du Ton..> | 2025-05-05 18:23 | - | |
| On The Verge/ | 2025-05-05 18:23 | - | |
| Nous Voulons Tous Ê..> | 2025-05-05 18:23 | - | |
| Northern Rescue/ | 2025-05-05 18:23 | - | |
| Normal People/ | 2025-05-05 18:23 | - | |
| Ninja Kamui/ | 2025-05-05 18:23 | - | |
| Nico Nickel Le Camio..> | 2025-05-05 18:23 | - | |
| Next/ | 2025-05-05 18:23 | - | |
| Newport Beach/ | 2025-05-05 18:23 | - | |
| Neumatt/ | 2025-05-05 18:23 | - | |
| Neon Genesis Evangel..> | 2025-05-05 18:23 | - | |
| Ne Téloigne Pas/ | 2025-05-05 18:23 | - | |
| Ncis Sydney/ | 2025-05-05 18:23 | - | |
| Ncis Origins/ | 2025-05-05 18:23 | - | |
| Ncis Nouvelleorléans/ | 2025-05-05 18:23 | - | |
| Ncis Enquêtes Spéc..> | 2025-05-05 18:23 | - | |
| Narcoworld Histoires..> | 2025-05-05 18:23 | - | |
| Narcos/ | 2025-05-05 18:23 | - | |
| Nabilla Sans Filtre/ | 2025-05-05 18:23 | - | |
| N Wu Assassins/ | 2025-05-05 18:23 | - | |
| N The Spy/ | 2025-05-05 18:23 | - | |
| N The Last Kingdom/ | 2025-05-05 18:23 | - | |
| N Spinning Out/ | 2025-05-05 18:23 | - | |
| N Speakerine/ | 2025-05-05 18:23 | - | |
| N Somewhere Between/ | 2025-05-05 18:23 | - | |
| N Shera Et Les Princ..> | 2025-05-05 18:23 | - | |
| N Seven Seconds/ | 2025-05-05 18:23 | - | |
| N Roman Empire/ | 2025-05-05 18:23 | - | |
| N Prince Of Peoria/ | 2025-05-05 18:23 | - | |
| N Pine Gap/ | 2025-05-05 18:23 | - | |
| N Outlander/ | 2025-05-05 18:23 | - | |
| N October Faction/ | 2025-05-05 18:23 | - | |
| N Narcos/ | 2025-05-05 18:23 | - | |
| N Mortel/ | 2025-05-05 18:23 | - | |
| N Medal Of Honor Les..> | 2025-05-05 18:23 | - | |
| N Manhunt Unabomber/ | 2025-05-05 18:23 | - | |
| N Lhistoire De Kalie..> | 2025-05-05 18:23 | - | |
| N Les Voyageurs Du T..> | 2025-05-05 18:23 | - | |
| N Lady Dynamite/ | 2025-05-05 18:23 | - | |
| N La Méthode Kominsky/ | 2025-05-05 18:23 | - | |
| N La Frontière Verte/ | 2025-05-05 18:23 | - | |
| N Kong Le Roi Des Si..> | 2025-05-05 18:23 | - | |
| N Jusquà Laube/ | 2025-05-05 18:23 | - | |
| N In Extremis Des At..> | 2025-05-05 18:23 | - | |
| N Huge En France/ | 2025-05-05 18:23 | - | |
| N Gypsy/ | 2025-05-05 18:23 | - | |
| N Girlboss/ | 2025-05-05 18:23 | - | |
| N Ghoul/ | 2025-05-05 18:23 | - | |
| N Fast Furious Les E..> | 2025-05-05 18:23 | - | |
| N Family Business/ | 2025-05-05 18:23 | - | |
| N Ever After High/ | 2025-05-05 18:23 | - | |
| N El Marginal/ | 2025-05-05 18:23 | - | |
| N Dirty John/ | 2025-05-05 18:23 | - | |
| N Dino Girl Gauko/ | 2025-05-05 18:23 | - | |
| N Diablero/ | 2025-05-05 18:23 | - | |
| N Dating Around/ | 2025-05-05 18:23 | - | |
| N Cheer/ | 2025-05-05 18:23 | - | |
| N Boardwalk Empire/ | 2025-05-05 18:23 | - | |
| N Between/ | 2025-05-05 18:23 | - | |
| Mythic Quest Le Fest..> | 2025-05-05 18:23 | - | |
| My Name/ | 2025-05-05 18:23 | - | |
| My Little Pony Marqu..> | 2025-05-05 18:23 | - | |
| My Life Is Murder/ | 2025-05-05 18:23 | - | |
| My Lady Jane/ | 2025-05-05 18:23 | - | |
| My Hero Academia/ | 2025-05-05 18:23 | - | |
| Musclor Et Les Maît..> | 2025-05-05 18:23 | - | |
| Mrs Davis/ | 2025-05-05 18:23 | - | |
| Mrs America/ | 2025-05-05 18:23 | - | |
| Mr Plankton/ | 2025-05-05 18:23 | - | |
| Mr Corman/ | 2025-05-05 18:23 | - | |
| Mr Bates Vs The Post..> | 2025-05-05 18:23 | - | |
| Motogp Unlimited/ | 2025-05-05 18:23 | - | |
| Moonshine/ | 2025-05-05 18:23 | - | |
| Moonhaven/ | 2025-05-05 18:23 | - | |
| Moonbase 8/ | 2025-05-05 18:23 | - | |
| Mood/ | 2025-05-05 18:23 | - | |
| Monstres Lhistoire D..> | 2025-05-05 18:23 | - | |
| Monstres Cie Au Trav..> | 2025-05-05 18:23 | - | |
| Monsterland/ | 2025-05-05 18:23 | - | |
| Monarca/ | 2025-05-05 18:23 | - | |
| Molang/ | 2025-05-05 18:23 | - | |
| Modern Love/ | 2025-05-05 18:23 | - | |
| Mob Psycho 100/ | 2025-05-05 18:23 | - | |
| Mister8/ | 2025-05-05 18:23 | - | |
| Missing Disparus San..> | 2025-05-05 18:23 | - | |
| Miniaturiste/ | 2025-05-05 18:23 | - | |
| Mindhunter/ | 2025-05-05 18:23 | - | |
| Mind Games/ | 2025-05-05 18:23 | - | |
| Mes Premières Fois/ | 2025-05-05 18:23 | - | |
| Merlí Sapere Aude/ | 2025-05-05 18:23 | - | |
| Mercredi/ | 2025-05-05 18:23 | - | |
| Mentiras/ | 2025-05-05 18:23 | - | |
| Medium/ | 2025-05-05 18:23 | - | |
| Medical Police/ | 2025-05-05 18:23 | - | |
| Mcmafia/ | 2025-05-05 18:23 | - | |
| Mcdonald Et Dodds/ | 2025-05-05 18:23 | - | |
| Mayor Of Kingstown/ | 2025-05-05 18:23 | - | |
| Maya Princesse Guerr..> | 2025-05-05 18:23 | - | |
| Mary Kills People/ | 2025-05-05 18:23 | - | |
| Marvels Runaways/ | 2025-05-05 18:23 | - | |
| Marvels Rocket Groot/ | 2025-05-05 18:23 | - | |
| Marvels Luke Cage/ | 2025-05-05 18:23 | - | |
| Marvels Iron Fist/ | 2025-05-05 18:23 | - | |
| Marvels Daredevil/ | 2025-05-05 18:23 | - | |
| Marvel Les Agents Du..> | 2025-05-05 18:23 | - | |
| Marc Márquez All In/ | 2025-05-05 18:23 | - | |
| Manipulations/ | 2025-05-05 18:23 | - | |
| Manifest/ | 2025-05-05 18:23 | - | |
| Mammifères/ | 2025-05-05 18:23 | - | |
| Malibu Rescue La Sé..> | 2025-05-05 18:23 | - | |
| Maldivas/ | 2025-05-05 18:23 | - | |
| Mafiosa/ | 2025-05-05 18:23 | - | |
| Made For Love/ | 2025-05-05 18:23 | - | |
| Madam Secretary 2014/ | 2025-05-05 18:23 | - | |
| Mad Men/ | 2025-05-05 18:23 | - | |
| Macgyver/ | 2025-05-05 18:23 | - | |
| M Le Maudit/ | 2025-05-05 18:23 | - | |
| Luna Park/ | 2025-05-05 18:23 | - | |
| Lucky Hank/ | 2025-05-05 18:23 | - | |
| Lucifer/ | 2025-05-05 18:23 | - | |
| Lt21/ | 2025-05-05 18:23 | - | |
| Love Victor/ | 2025-05-05 18:23 | - | |
| Love Death/ | 2025-05-05 18:23 | - | |
| Louis La Brocante/ | 2025-05-05 18:23 | - | |
| Log Horizon/ | 2025-05-05 18:23 | - | |
| Lincroyable Emboutei..> | 2025-05-05 18:23 | - | |
| Limprobable Assassin..> | 2025-05-05 18:23 | - | |
| Lie To Me/ | 2025-05-05 18:23 | - | |
| Liar La Nuit Du Mens..> | 2025-05-05 18:23 | - | |
| Liaison Fatale/ | 2025-05-05 18:23 | - | |
| Lhomme Que Jai Conda..> | 2025-05-05 18:23 | - | |
| Lexorciste/ | 2025-05-05 18:23 | - | |
| Lessor De Lempire Ot..> | 2025-05-05 18:23 | - | |
| Les Zinzins De Lespace/ | 2025-05-05 18:23 | - | |
| Les Veuves Du Jeudi/ | 2025-05-05 18:23 | - | |
| Les Simpson/ | 2025-05-05 18:23 | - | |
| Les Routes Du Paradis/ | 2025-05-05 18:23 | - | |
| Les Rescapés De Lar..> | 2025-05-05 18:23 | - | |
| Les Périls De Lamour/ | 2025-05-05 18:23 | - | |
| Les Oubliés/ | 2025-05-05 18:23 | - | |
| Les Ombres Rouges/ | 2025-05-05 18:23 | - | |
| Les Nouvelles Aventu..> | 2025-05-05 18:23 | - | |
| Les Nouveaux Bandits/ | 2025-05-05 18:23 | - | |
| Les Maîtres De Luni..> | 2025-05-05 18:23 | - | |
| Les Kennedy/ | 2025-05-05 18:23 | - | |
| Les Justicières Reb..> | 2025-05-05 18:23 | - | |
| Les Irréguliers De ..> | 2025-05-05 18:23 | - | |
| Les Héritiers De La..> | 2025-05-05 18:23 | - | |
| Les Griffin/ | 2025-05-05 18:23 | - | |
| Les Frères Scott/ | 2025-05-05 18:23 | - | |
| Les Frères Hardy/ | 2025-05-05 18:23 | - | |
| Les Fleurs Sauvages/ | 2025-05-05 18:23 | - | |
| Les Enquêtes De Morse/ | 2025-05-05 18:23 | - | |
| Les Disparus De La F..> | 2025-05-05 18:23 | - | |
| Les Condamnées/ | 2025-05-05 18:23 | - | |
| Les Bombes/ | 2025-05-05 18:23 | - | |
| Les Aventures Extrao..> | 2025-05-05 18:23 | - | |
| Les Aventures De Tin..> | 2025-05-05 18:23 | - | |
| Le Temps Des Samoura..> | 2025-05-05 18:23 | - | |
| Le Temps De Toublier/ | 2025-05-05 18:23 | - | |
| Le Tailleur/ | 2025-05-05 18:23 | - | |
| Le Silence De Leau/ | 2025-05-05 18:23 | - | |
| Le Seigneur Des Anne..> | 2025-05-05 18:23 | - | |
| Le Secret De Nick/ | 2025-05-05 18:23 | - | |
| Le Problème À 3 Co..> | 2025-05-05 18:23 | - | |
| Le Pouvoir/ | 2025-05-05 18:23 | - | |
| Le Monde De Karma/ | 2025-05-05 18:23 | - | |
| Le Mauvais Camp La S..> | 2025-05-05 18:23 | - | |
| Le Gang Du Gant Vert/ | 2025-05-05 18:23 | - | |
| Le Frelon Vert/ | 2025-05-05 18:23 | - | |
| Le Domaine/ | 2025-05-05 18:23 | - | |
| Le Destin De Lisa/ | 2025-05-05 18:23 | - | |
| Le Continental Dapr..> | 2025-05-05 18:23 | - | |
| Le Chemin De Lolivier/ | 2025-05-05 18:23 | - | |
| Le Cerveau En Bref/ | 2025-05-05 18:23 | - | |
| Le Cabinet De Curios..> | 2025-05-05 18:23 | - | |
| Lawmen Lhistoire De ..> | 2025-05-05 18:23 | - | |
| Lart Du Crime/ | 2025-05-05 18:23 | - | |
| Lart De Lespionnage/ | 2025-05-05 18:23 | - | |
| Larme Fatale/ | 2025-05-05 18:23 | - | |
| Lapin Samouraï Les ..> | 2025-05-05 18:23 | - | |
| Landscapers/ | 2025-05-05 18:23 | - | |
| Lamour Flou/ | 2025-05-05 18:23 | - | |
| Lamie Prodigieuse/ | 2025-05-05 18:23 | - | |
| Labsente/ | 2025-05-05 18:23 | - | |
| Labîme/ | 2025-05-05 18:23 | - | |
| La Vérité Sur Laff..> | 2025-05-05 18:23 | - | |
| La Reine Du Flow/ | 2025-05-05 18:23 | - | |
| La Quatrième Dimens..> | 2025-05-05 18:23 | - | |
| La Nuit Sera Longue/ | 2025-05-05 18:23 | - | |
| La Nouvelle Famille ..> | 2025-05-05 18:23 | - | |
| La Montagne Aux Secr..> | 2025-05-05 18:23 | - | |
| La Maison Den Face/ | 2025-05-05 18:23 | - | |
| La Grande Imposture/ | 2025-05-05 18:23 | - | |
| La Folle Histoire Du..> | 2025-05-05 18:23 | - | |
| La Fille Invisible/ | 2025-05-05 18:23 | - | |
| La Disparue De Løre..> | 2025-05-05 18:23 | - | |
| La Défense Lincoln/ | 2025-05-05 18:23 | - | |
| La Crue/ | 2025-05-05 18:23 | - | |
| La Chance De Ta Vie/ | 2025-05-05 18:23 | - | |
| La Catedral Del Mar/ | 2025-05-05 18:23 | - | |
| La Casa De Papel De ..> | 2025-05-05 18:23 | - | |
| La Cage/ | 2025-05-05 18:23 | - | |
| Létoffe Des Héros/ | 2025-05-05 18:23 | - | |
| Léo Matteï Brigade..> | 2025-05-05 18:23 | - | |
| Léna Rêve Détoile/ | 2025-05-05 18:23 | - | |
| Kurokos Basket/ | 2025-05-05 18:23 | - | |
| Kung Fu Vost/ | 2025-05-05 18:23 | - | |
| Kung Fu Panda The Pa..> | 2025-05-05 18:23 | - | |
| Kung Fu Panda Le Che..> | 2025-05-05 18:23 | - | |
| Knuckles/ | 2025-05-05 18:23 | - | |
| Kleo/ | 2025-05-05 18:23 | - | |
| Kingdom/ | 2025-05-05 18:23 | - | |
| Killjoys/ | 2025-05-05 18:23 | - | |
| Killing Bites Vost/ | 2025-05-05 18:23 | - | |
| Kidou Senshi Gundam ..> | 2025-05-05 18:23 | - | |
| Kid Cosmic/ | 2025-05-05 18:23 | - | |
| Ken Le Survivant/ | 2025-05-05 18:23 | - | |
| Kandagawa Jet Girls/ | 2025-05-05 18:23 | - | |
| Kakegurui/ | 2025-05-05 18:23 | - | |
| Kaiju No 8/ | 2025-05-05 18:23 | - | |
| Kabukichou Sherlock/ | 2025-05-05 18:23 | - | |
| Kaboul Kitchen/ | 2025-05-05 18:23 | - | |
| Kaamelott/ | 2025-05-05 18:23 | - | |
| K2000/ | 2025-05-05 18:23 | - | |
| Kördüğüm/ | 2025-05-05 18:23 | - | |
| Just Add Magic Myste..> | 2025-05-05 18:23 | - | |
| Jusquici Tout Va Bien/ | 2025-05-05 18:23 | - | |
| Jurassic World La Co..> | 2025-05-05 18:23 | - | |
| Joy/ | 2025-05-05 18:23 | - | |
| João De Deus Cura E..> | 2025-05-05 18:23 | - | |
| Jinn/ | 2025-05-05 18:23 | - | |
| Jett/ | 2025-05-05 18:23 | - | |
| Je Déteste Noël/ | 2025-05-05 18:23 | - | |
| Jayce Et Les Conqué..> | 2025-05-05 18:23 | - | |
| Jane The Virgin/ | 2025-05-05 18:23 | - | |
| Jane Austen Bienvenu..> | 2025-05-05 18:23 | - | |
| Jane/ | 2025-05-05 18:23 | - | |
| Izombie/ | 2025-05-05 18:23 | - | |
| Inventing Anna/ | 2025-05-05 18:23 | - | |
| Into The Night/ | 2025-05-05 18:23 | - | |
| Interrogation/ | 2025-05-05 18:23 | - | |
| Intergalactic/ | 2025-05-05 18:23 | - | |
| Inspecteur Gadget/ | 2025-05-05 18:23 | - | |
| Insoupçonnable/ | 2025-05-05 18:23 | - | |
| Inside Man/ | 2025-05-05 18:23 | - | |
| Inside Job/ | 2025-05-05 18:23 | - | |
| Insecure/ | 2025-05-05 18:23 | - | |
| Insatiable/ | 2025-05-05 18:23 | - | |
| Insania/ | 2025-05-05 18:23 | - | |
| Innocent/ | 2025-05-05 18:23 | - | |
| Infiniti/ | 2025-05-05 18:23 | - | |
| Industry/ | 2025-05-05 18:23 | - | |
| In The Dark/ | 2025-05-05 18:23 | - | |
| Ils Étaient Dix/ | 2025-05-05 18:23 | - | |
| Il Miracolo/ | 2025-05-05 18:23 | - | |
| Icarly/ | 2025-05-05 18:23 | - | |
| I May Destroy You/ | 2025-05-05 18:23 | - | |
| I3P/ | 2025-05-05 18:23 | - | |
| Hysteria/ | 2025-05-05 18:23 | - | |
| Humans/ | 2025-05-05 18:23 | - | |
| How To Ruin Christma..> | 2025-05-05 18:23 | - | |
| House Of The Dragon/ | 2025-05-05 18:23 | - | |
| Hot Skull/ | 2025-05-05 18:23 | - | |
| Horreur À Séoul La..> | 2025-05-05 18:23 | - | |
| Homeland/ | 2025-05-05 18:23 | - | |
| Homecoming/ | 2025-05-05 18:23 | - | |
| Home Before Dark/ | 2025-05-05 18:23 | - | |
| Hjørdis/ | 2025-05-05 18:23 | - | |
| Histoire De Lisey/ | 2025-05-05 18:23 | - | |
| Hightown/ | 2025-05-05 18:23 | - | |
| High School Prodigie..> | 2025-05-05 18:23 | - | |
| High School Musical ..> | 2025-05-05 18:23 | - | |
| Hierro/ | 2025-05-05 18:23 | - | |
| Hidden/ | 2025-05-05 18:23 | - | |
| Heroes/ | 2025-05-05 18:23 | - | |
| Hero Mask/ | 2025-05-05 18:23 | - | |
| Her Voice/ | 2025-05-05 18:23 | - | |
| Hellsing/ | 2025-05-05 18:23 | - | |
| Heirs Of The Night/ | 2025-05-05 18:23 | - | |
| Heels/ | 2025-05-05 18:23 | - | |
| Heartstopper/ | 2025-05-05 18:23 | - | |
| Hawaii 50/ | 2025-05-05 18:23 | - | |
| Harry Bosch/ | 2025-05-05 18:23 | - | |
| Hard Sun/ | 2025-05-05 18:23 | - | |
| Hannibal/ | 2025-05-05 18:23 | - | |
| Hacks/ | 2025-05-05 18:23 | - | |
| H 1998/ | 2025-05-05 18:23 | - | |
| Gto/ | 2025-05-05 18:23 | - | |
| Grownish/ | 2025-05-05 18:23 | - | |
| Grotesquerie/ | 2025-05-05 18:23 | - | |
| Grimm/ | 2025-05-05 18:23 | - | |
| Grease Rise Of The P..> | 2025-05-05 18:23 | - | |
| Grand Hôtel/ | 2025-05-05 18:23 | - | |
| Grace Et Frankie/ | 2025-05-05 18:23 | - | |
| Good Omens/ | 2025-05-05 18:23 | - | |
| Good Girls Revolt/ | 2025-05-05 18:23 | - | |
| Goliath/ | 2025-05-05 18:23 | - | |
| Godfather Of Harlem/ | 2025-05-05 18:23 | - | |
| Gloria/ | 2025-05-05 18:23 | - | |
| Glitch/ | 2025-05-05 18:23 | - | |
| Girls5Eva/ | 2025-05-05 18:23 | - | |
| Ginny Georgia/ | 2025-05-05 18:23 | - | |
| Gentefied/ | 2025-05-05 18:23 | - | |
| Genius/ | 2025-05-05 18:23 | - | |
| Gen V/ | 2025-05-05 18:23 | - | |
| Gegege No Kitaro/ | 2025-05-05 18:23 | - | |
| Gabby Et La Maison M..> | 2025-05-05 18:23 | - | |
| Future Man/ | 2025-05-05 18:23 | - | |
| Fullmetal Alchemist ..> | 2025-05-05 18:23 | - | |
| Frenchie Shore/ | 2025-05-05 18:23 | - | |
| Freeridge/ | 2025-05-05 18:23 | - | |
| Frasier/ | 2025-05-05 18:23 | - | |
| Fragile/ | 2025-05-05 18:23 | - | |
| Frères Darmes/ | 2025-05-05 18:23 | - | |
| Fosseverdon/ | 2025-05-05 18:23 | - | |
| Force Honneur/ | 2025-05-05 18:23 | - | |
| For Life/ | 2025-05-05 18:23 | - | |
| Flashforward/ | 2025-05-05 18:23 | - | |
| First Love/ | 2025-05-05 18:23 | - | |
| First Kill/ | 2025-05-05 18:23 | - | |
| Fires/ | 2025-05-05 18:23 | - | |
| Fire Country/ | 2025-05-05 18:23 | - | |
| Filles Du Feu/ | 2025-05-05 18:23 | - | |
| Feedback/ | 2025-05-05 18:23 | - | |
| Fbi International/ | 2025-05-05 18:23 | - | |
| Fbi/ | 2025-05-05 18:23 | - | |
| Fauxsemblants/ | 2025-05-05 18:23 | - | |
| Faux Profil/ | 2025-05-05 18:23 | - | |
| Fauda/ | 2025-05-05 18:23 | - | |
| Fatestay Night/ | 2025-05-05 18:23 | - | |
| Fatal Seduction/ | 2025-05-05 18:23 | - | |
| Farinia/ | 2025-05-05 18:23 | - | |
| Fanático/ | 2025-05-05 18:23 | - | |
| Fallout/ | 2025-05-05 18:23 | - | |
| Falcon Et Le Soldat ..> | 2025-05-05 18:23 | - | |
| Faites Des Gosses/ | 2025-05-05 18:23 | - | |
| Fairy Gone/ | 2025-05-05 18:23 | - | |
| F Is For Family/ | 2025-05-05 18:23 | - | |
| Express/ | 2025-05-05 18:23 | - | |
| Evil/ | 2025-05-05 18:23 | - | |
| Euphoria/ | 2025-05-05 18:23 | - | |
| Ethos 2020/ | 2025-05-05 18:23 | - | |
| Et Si Cétait Mon Fils/ | 2025-05-05 18:23 | - | |
| Ergo Proxy/ | 2025-05-05 18:23 | - | |
| Entrapped/ | 2025-05-05 18:23 | - | |
| Enterrement De Vie D..> | 2025-05-05 18:23 | - | |
| Enquête À Cœur Ou..> | 2025-05-05 18:23 | - | |
| Engrenages/ | 2025-05-05 18:23 | - | |
| English Teacher/ | 2025-05-05 18:23 | - | |
| Emily In Paris/ | 2025-05-05 18:23 | - | |
| El Cid/ | 2025-05-05 18:23 | - | |
| Edens Zero/ | 2025-05-05 18:23 | - | |
| Dune Main De Fer/ | 2025-05-05 18:23 | - | |
| Ducktales/ | 2025-05-05 18:23 | - | |
| Dublin Murders/ | 2025-05-05 18:23 | - | |
| Drug Lords The Next ..> | 2025-05-05 18:23 | - | |
| Dragon Ball Z Yabai/ | 2025-05-05 18:23 | - | |
| Dragon Ball Yabai/ | 2025-05-05 18:23 | - | |
| Dragon Ball Gt/ | 2025-05-05 18:23 | - | |
| Downton Abbey/ | 2025-05-05 18:23 | - | |
| Doug Le Robot Curieux/ | 2025-05-05 18:23 | - | |
| Dororo/ | 2025-05-05 18:23 | - | |
| Dom/ | 2025-05-05 18:23 | - | |
| Dolly Partons Hearts..> | 2025-05-05 18:23 | - | |
| Docteur Odyssey/ | 2025-05-05 18:23 | - | |
| Dive Club/ | 2025-05-05 18:23 | - | |
| Disparu À Jamais/ | 2025-05-05 18:23 | - | |
| Disparitions La Cour..> | 2025-05-05 18:23 | - | |
| Dirty Lines/ | 2025-05-05 18:23 | - | |
| Directrice/ | 2025-05-05 18:23 | - | |
| Diane De Poitiers/ | 2025-05-05 18:23 | - | |
| Diamants Bruts/ | 2025-05-05 18:23 | - | |
| Dexter New Blood/ | 2025-05-05 18:23 | - | |
| Devils/ | 2025-05-05 18:23 | - | |
| Derrière Les Barreaux/ | 2025-05-05 18:23 | - | |
| Demon Slayer Kimetsu..> | 2025-05-05 18:23 | - | |
| Debris Vost/ | 2025-05-05 18:23 | - | |
| Death Note/ | 2025-05-05 18:23 | - | |
| Dead Still/ | 2025-05-05 18:23 | - | |
| Dating Around/ | 2025-05-05 18:23 | - | |
| Dash Lily/ | 2025-05-05 18:23 | - | |
| Dargent Et De Sang/ | 2025-05-05 18:23 | - | |
| Dans Lunivers Des Na..> | 2025-05-05 18:23 | - | |
| Danger Force/ | 2025-05-05 18:23 | - | |
| Daisy Jones The Six/ | 2025-05-05 18:23 | - | |
| Détective Conan/ | 2025-05-05 18:23 | - | |
| Désordres/ | 2025-05-05 18:23 | - | |
| Défendre Jacob/ | 2025-05-05 18:23 | - | |
| Cursed La Rebelle/ | 2025-05-05 18:23 | - | |
| Curfew/ | 2025-05-05 18:23 | - | |
| Csi Vegas/ | 2025-05-05 18:23 | - | |
| Cryptid/ | 2025-05-05 18:23 | - | |
| Criminal Espagne/ | 2025-05-05 18:23 | - | |
| Criminal Allemagne/ | 2025-05-05 18:23 | - | |
| Crime Scene The Time..> | 2025-05-05 18:23 | - | |
| Crash/ | 2025-05-05 18:23 | - | |
| Coyote/ | 2025-05-05 18:23 | - | |
| Countrymen/ | 2025-05-05 18:23 | - | |
| Counterpart/ | 2025-05-05 18:23 | - | |
| Conversations With F..> | 2025-05-05 18:23 | - | |
| Condor/ | 2025-05-05 18:23 | - | |
| Comment Élever Un S..> | 2025-05-05 18:23 | - | |
| Comme Des Gosses/ | 2025-05-05 18:23 | - | |
| Commandant Saintbarth/ | 2025-05-05 18:23 | - | |
| Come Home/ | 2025-05-05 18:23 | - | |
| Colony/ | 2025-05-05 18:23 | - | |
| Colin En Noir Et Blanc/ | 2025-05-05 18:23 | - | |
| Clem/ | 2025-05-05 18:23 | - | |
| Claws/ | 2025-05-05 18:23 | - | |
| Clarice Vost/ | 2025-05-05 18:23 | - | |
| Claire Et Les Vieux/ | 2025-05-05 18:23 | - | |
| Citadel Honey Bunny/ | 2025-05-05 18:23 | - | |
| Chocolat Amer/ | 2025-05-05 18:23 | - | |
| Chesapeake Shores/ | 2025-05-05 18:23 | - | |
| Chernobyl/ | 2025-05-05 18:23 | - | |
| Cheer/ | 2025-05-05 18:23 | - | |
| Chastity High/ | 2025-05-05 18:23 | - | |
| Chasseurs De Trolls ..> | 2025-05-05 18:23 | - | |
| Charlie Au Pays Des ..> | 2025-05-05 18:23 | - | |
| Chaque Fidélité/ | 2025-05-05 18:23 | - | |
| Chapelwaite/ | 2025-05-05 18:23 | - | |
| Channel Zero/ | 2025-05-05 18:23 | - | |
| Cest Comme Ça Que J..> | 2025-05-05 18:23 | - | |
| Cats Eyes/ | 2025-05-05 18:23 | - | |
| Castle/ | 2025-05-05 18:23 | - | |
| Cassandre/ | 2025-05-05 18:23 | - | |
| Carrément Craignos/ | 2025-05-05 18:23 | - | |
| Carmen Sandiego/ | 2025-05-05 18:23 | - | |
| Captain Tsubasa/ | 2025-05-05 18:23 | - | |
| Californication/ | 2025-05-05 18:23 | - | |
| Caïd/ | 2025-05-05 18:23 | - | |
| Cœurs Noirs/ | 2025-05-05 18:23 | - | |
| Bullit Et Riper/ | 2025-05-05 18:23 | - | |
| Britannia/ | 2025-05-05 18:23 | - | |
| Breeders/ | 2025-05-05 18:23 | - | |
| Bobs Burgers/ | 2025-05-05 18:23 | - | |
| Boat Story/ | 2025-05-05 18:23 | - | |
| Bluff City Law/ | 2025-05-05 18:23 | - | |
| Blue Lock/ | 2025-05-05 18:23 | - | |
| Blue Bloods/ | 2025-05-05 18:23 | - | |
| Bloodline/ | 2025-05-05 18:23 | - | |
| Blindspotting/ | 2025-05-05 18:23 | - | |
| Bleach Kai/ | 2025-05-05 18:23 | - | |
| Blade La Série/ | 2025-05-05 18:23 | - | |
| Blackaf/ | 2025-05-05 18:23 | - | |
| Black Summer/ | 2025-05-05 18:23 | - | |
| Black Space/ | 2025-05-05 18:23 | - | |
| Black Narcissus/ | 2025-05-05 18:23 | - | |
| Black Knight/ | 2025-05-05 18:23 | - | |
| Black Clover/ | 2025-05-05 18:23 | - | |
| Billy The Kid/ | 2025-05-05 18:23 | - | |
| Big Nate/ | 2025-05-05 18:23 | - | |
| Bienvenue Chez Les L..> | 2025-05-05 18:23 | - | |
| Beyond Goodbye/ | 2025-05-05 18:23 | - | |
| Better Things/ | 2025-05-05 18:23 | - | |
| Berlin Station/ | 2025-05-05 18:23 | - | |
| Belascoarán Détect..> | 2025-05-05 18:23 | - | |
| Belair/ | 2025-05-05 18:23 | - | |
| Baymax/ | 2025-05-05 18:23 | - | |
| Battlestar Galactica/ | 2025-05-05 18:23 | - | |
| Battle Through The H..> | 2025-05-05 18:23 | - | |
| Batman Caped Crusader/ | 2025-05-05 18:23 | - | |
| Bates Motel/ | 2025-05-05 18:23 | - | |
| Barbie Dreamhouse Ad..> | 2025-05-05 18:23 | - | |
| Barbarians/ | 2025-05-05 18:23 | - | |
| Barbares/ | 2025-05-05 18:23 | - | |
| Bang Bang Baby/ | 2025-05-05 18:23 | - | |
| Balthazar/ | 2025-05-05 18:23 | - | |
| Baki The Grappler/ | 2025-05-05 18:23 | - | |
| Bad Vegan Arnaque Au..> | 2025-05-05 18:23 | - | |
| Baby/ | 2025-05-05 18:23 | - | |
| Away/ | 2025-05-05 18:23 | - | |
| Avenue 5/ | 2025-05-05 18:23 | - | |
| Au Service Du Passé/ | 2025-05-05 18:23 | - | |
| Au Royaume Des Fauves/ | 2025-05-05 18:23 | - | |
| Au Nom De La Vengeance/ | 2025-05-05 18:23 | - | |
| Astrid Lilly Sauvent..> | 2025-05-05 18:23 | - | |
| Aspergirl/ | 2025-05-05 18:23 | - | |
| Arthurs Law/ | 2025-05-05 18:23 | - | |
| Arrested Development/ | 2025-05-05 18:23 | - | |
| Arrête De Me Chauff..> | 2025-05-05 18:23 | - | |
| Archie The Man Who B..> | 2025-05-05 18:23 | - | |
| Arıza/ | 2025-05-05 18:23 | - | |
| Après Toi Le Chaos/ | 2025-05-05 18:23 | - | |
| Après/ | 2025-05-05 18:23 | - | |
| Appellemoi Si Tu Meurs/ | 2025-05-05 18:23 | - | |
| Ap Star Trek Lower D..> | 2025-05-05 18:23 | - | |
| Ap Power Book Iii Ra..> | 2025-05-05 18:23 | - | |
| Ap Linternat Las Cum..> | 2025-05-05 18:23 | - | |
| Ap El Cid/ | 2025-05-05 18:23 | - | |
| Anthracite/ | 2025-05-05 18:23 | - | |
| Angel/ | 2025-05-05 18:23 | - | |
| Andropause/ | 2025-05-05 18:23 | - | |
| And Then There Were ..> | 2025-05-05 18:23 | - | |
| American Vandal/ | 2025-05-05 18:23 | - | |
| American Gods/ | 2025-05-05 18:23 | - | |
| American Gigolo/ | 2025-05-05 18:23 | - | |
| American Crime Story/ | 2025-05-05 18:23 | - | |
| Allô La Terre Ici Ned/ | 2025-05-05 18:23 | - | |
| Alias/ | 2025-05-05 18:23 | - | |
| Alf/ | 2025-05-05 18:23 | - | |
| Alex Rider/ | 2025-05-05 18:23 | - | |
| Aj And The Queen/ | 2025-05-05 18:23 | - | |
| Air Cocaïne 2023/ | 2025-05-05 18:23 | - | |
| Ahiru No Sora/ | 2025-05-05 18:23 | - | |
| Aggretsuko/ | 2025-05-05 18:23 | - | |
| Ag3Nda/ | 2025-05-05 18:23 | - | |
| Access/ | 2025-05-05 18:23 | - | |
| Abla Fahita Drama Qu..> | 2025-05-05 18:23 | - | |
| Abbott Elementary/ | 2025-05-05 18:23 | - | |
| A Very British Scandal/ | 2025-05-05 18:23 | - | |
| A Private Affair/ | 2025-05-05 18:23 | - | |
| A Model Family/ | 2025-05-05 18:23 | - | |
| A Gentleman In Moscow/ | 2025-05-05 18:23 | - | |
| A Black Lady Sketch ..> | 2025-05-05 18:23 | - | |
| 221163/ | 2025-05-05 18:23 | - | |
| 3945 En Couleur Vers..> | 2025-05-05 18:23 | - | |
| 1985/ | 2025-05-05 18:23 | - | |
| 1899/ | 2025-05-05 18:23 | - | |
| 911 Lone Star/ | 2025-05-05 18:23 | - | |
| 42 Jours Dobscurité/ | 2025-05-05 18:23 | - | |
| 12 Monkeys/ | 2025-05-05 18:23 | - | |
| 7Seeds/ | 2025-05-05 18:23 | - | |
| 3/ | 2025-05-05 18:23 | - | |
| 2 Flics À Miami/ | 2025-05-05 18:23 | - | |
| Équipe Action/ | 2025-05-05 18:23 | - | |
| Élu Entre Tous/ | 2025-05-05 18:23 | - | |
| Élite Histoires Cou..> | 2025-05-05 18:23 | - | |
| Élite Histoires Cou..> | 2025-05-05 18:23 | - | |
| Échos/ | 2025-05-05 18:23 | - | |